C16H23BrN2O2 — CID 60682587
(3-bromo-4-methoxyphenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone (PubChem CID 60682587) has the molecular formula C16H23BrN2O2 and a molecular weight of 355.28 g/mol. Its IUPAC name is (3-bromo-4-methoxyphenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone.
| Compound Name | (3-bromo-4-methoxyphenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 60682587 |
| Molecular Formula | C16H23BrN2O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | (3-bromo-4-methoxyphenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCN(CC(C)C)CC2)cc1Br |
| InChI | InChI=1S/C16H23BrN2O2/c1-12(2)11-18-6-8-19(9-7-18)16(20)13-4-5-15(21-3)14(17)10-13/h4-5,10,12H,6-9,11H2,1-3H3 |
| InChIKey | QNKKUUUMYDGLJZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |