C20H19Cl2NO4 — CID 139747643
[4-[3-(2,6-dichloro-4-hydroxyphenoxy)propoxy]phenyl]-(2,5-dihydropyrrol-1-yl)methanone (PubChem CID 139747643) has the molecular formula C20H19Cl2NO4 and a molecular weight of 408.28 g/mol. Its IUPAC name is [4-[3-(2,6-dichloro-4-hydroxyphenoxy)propoxy]phenyl]-(2,5-dihydropyrrol-1-yl)methanone.
| Compound Name | [4-[3-(2,6-dichloro-4-hydroxyphenoxy)propoxy]phenyl]-(2,5-dihydropyrrol-1-yl)methanone |
|---|---|
| PubChem CID | 139747643 |
| Molecular Formula | C20H19Cl2NO4 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | [4-[3-(2,6-dichloro-4-hydroxyphenoxy)propoxy]phenyl]-(2,5-dihydropyrrol-1-yl)methanone |
| SMILES | O=C(c1ccc(OCCCOc2c(Cl)cc(O)cc2Cl)cc1)N1CC=CC1 |
| InChI | InChI=1S/C20H19Cl2NO4/c21-17-12-15(24)13-18(22)19(17)27-11-3-10-26-16-6-4-14(5-7-16)20(25)23-8-1-2-9-23/h1-2,4-7,12-13,24H,3,8-11H2 |
| InChIKey | GZDNIZQFUAXCLP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|