C23H29Cl2NO5 — CID 67719154
[4-[4-(2,6-dichloro-4-hydroxyphenoxy)butoxy]phenyl] N,N-dipropylcarbamate (PubChem CID 67719154) has the molecular formula C23H29Cl2NO5 and a molecular weight of 470.39 g/mol. Its IUPAC name is [4-[4-(2,6-dichloro-4-hydroxyphenoxy)butoxy]phenyl] N,N-dipropylcarbamate.
| Compound Name | [4-[4-(2,6-dichloro-4-hydroxyphenoxy)butoxy]phenyl] N,N-dipropylcarbamate |
|---|---|
| PubChem CID | 67719154 |
| Molecular Formula | C23H29Cl2NO5 |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | [4-[4-(2,6-dichloro-4-hydroxyphenoxy)butoxy]phenyl] N,N-dipropylcarbamate |
| SMILES | CCCN(CCC)C(=O)Oc1ccc(OCCCCOc2c(Cl)cc(O)cc2Cl)cc1 |
| InChI | InChI=1S/C23H29Cl2NO5/c1-3-11-26(12-4-2)23(28)31-19-9-7-18(8-10-19)29-13-5-6-14-30-22-20(24)15-17(27)16-21(22)25/h7-10,15-16,27H,3-6,11-14H2,1-2H3 |
| InChIKey | ZVPJISZXAMOEKR-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|