About (4-hydroxyphenyl) (4-propoxyphenyl) carbonate
(4-hydroxyphenyl) (4-propoxyphenyl) carbonate (PubChem CID 57144136) has the molecular formula C16H16O5
and a molecular weight of 288.30 g/mol. Its IUPAC name is (4-hydroxyphenyl) (4-propoxyphenyl) carbonate.
Molecular Properties
| Compound Name | (4-hydroxyphenyl) (4-propoxyphenyl) carbonate |
| PubChem CID | 57144136 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (4-hydroxyphenyl) (4-propoxyphenyl) carbonate |
| SMILES | CCCOc1ccc(OC(=O)Oc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C16H16O5/c1-2-11-19-13-7-9-15(10-8-13)21-16(18)20-14-5-3-12(17)4-6-14/h3-10,17H,2,11H2,1H3 |
| InChIKey | CRPUWROLSXKCLO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxyphenyl) (4-propoxyphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxyphenyl) (4-propoxyphenyl) carbonate?
The IUPAC name of (4-hydroxyphenyl) (4-propoxyphenyl) carbonate (CID 57144136) is (4-hydroxyphenyl) (4-propoxyphenyl) carbonate.
What is the SMILES notation for (4-hydroxyphenyl) (4-propoxyphenyl) carbonate?
The canonical SMILES for (4-hydroxyphenyl) (4-propoxyphenyl) carbonate is CCCOc1ccc(OC(=O)Oc2ccc(O)cc2)cc1.
What is the InChIKey of (4-hydroxyphenyl) (4-propoxyphenyl) carbonate?
The InChIKey is CRPUWROLSXKCLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O5/c1-2-11-19-13-7-9-15(10-8-13)21-16(18)20-14-5-3-12(17)4-6-14/h3-10,17H,2,11H2,1H3.
What are the key properties of (4-hydroxyphenyl) (4-propoxyphenyl) carbonate?
(4-hydroxyphenyl) (4-propoxyphenyl) carbonate has a molecular weight of 288.30 g/mol, XLogP of 3.76, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxyphenyl) (4-propoxyphenyl) carbonate is sourced from PubChem (CID 57144136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).