About (4-propoxyphenyl)methyl acetate
(4-propoxyphenyl)methyl acetate (PubChem CID 150263336) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is (4-propoxyphenyl)methyl acetate.
Molecular Properties
| Compound Name | (4-propoxyphenyl)methyl acetate |
| PubChem CID | 150263336 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (4-propoxyphenyl)methyl acetate |
| SMILES | CCCOc1ccc(COC(C)=O)cc1 |
| InChI | InChI=1S/C12H16O3/c1-3-8-14-12-6-4-11(5-7-12)9-15-10(2)13/h4-7H,3,8-9H2,1-2H3 |
| InChIKey | GBZXSMHBKJVPMA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-propoxyphenyl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propoxyphenyl)methyl acetate?
The IUPAC name of (4-propoxyphenyl)methyl acetate (CID 150263336) is (4-propoxyphenyl)methyl acetate.
What is the SMILES notation for (4-propoxyphenyl)methyl acetate?
The canonical SMILES for (4-propoxyphenyl)methyl acetate is CCCOc1ccc(COC(C)=O)cc1.
What is the InChIKey of (4-propoxyphenyl)methyl acetate?
The InChIKey is GBZXSMHBKJVPMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-3-8-14-12-6-4-11(5-7-12)9-15-10(2)13/h4-7H,3,8-9H2,1-2H3.
What are the key properties of (4-propoxyphenyl)methyl acetate?
(4-propoxyphenyl)methyl acetate has a molecular weight of 208.26 g/mol, XLogP of 2.54, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propoxyphenyl)methyl acetate is sourced from PubChem (CID 150263336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).