About [4-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]phenyl]methyl acetate
[4-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]phenyl]methyl acetate (PubChem CID 123402714) has the molecular formula C16H26O3S
and a molecular weight of 298.45 g/mol. Its IUPAC name is [4-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]phenyl]methyl acetate.
Molecular Properties
| Compound Name | [4-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]phenyl]methyl acetate |
| PubChem CID | 123402714 |
| Molecular Formula | C16H26O3S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | [4-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(OCS(C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26O3S/c1-13(17)18-11-14-7-9-15(10-8-14)19-12-20(5,6)16(2,3)4/h7-10H,11-12H2,1-6H3 |
| InChIKey | PUHNLXXBTYTULY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]phenyl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]phenyl]methyl acetate?
The IUPAC name of [4-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]phenyl]methyl acetate (CID 123402714) is [4-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]phenyl]methyl acetate.
What is the SMILES notation for [4-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]phenyl]methyl acetate?
The canonical SMILES for [4-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]phenyl]methyl acetate is CC(=O)OCc1ccc(OCS(C)(C)C(C)(C)C)cc1.
What is the InChIKey of [4-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]phenyl]methyl acetate?
The InChIKey is PUHNLXXBTYTULY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O3S/c1-13(17)18-11-14-7-9-15(10-8-14)19-12-20(5,6)16(2,3)4/h7-10H,11-12H2,1-6H3.
What are the key properties of [4-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]phenyl]methyl acetate?
[4-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]phenyl]methyl acetate has a molecular weight of 298.45 g/mol, XLogP of 3.95, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]phenyl]methyl acetate is sourced from PubChem (CID 123402714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).