C13H10O2 — CID 14195628
7H-benzo[7]annulene-6,8-dicarbaldehyde (PubChem CID 14195628) has the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 7H-benzo[7]annulene-6,8-dicarbaldehyde.
| Compound Name | 7H-benzo[7]annulene-6,8-dicarbaldehyde |
|---|---|
| PubChem CID | 14195628 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 7H-benzo[7]annulene-6,8-dicarbaldehyde |
| SMILES | O=CC1=Cc2ccccc2C=C(C=O)C1 |
| InChI | InChI=1S/C13H10O2/c14-8-10-5-11(9-15)7-13-4-2-1-3-12(13)6-10/h1-4,6-9H,5H2 |
| InChIKey | QWNHPTLLLNYEEU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|