C23H16BrNO3 — CID 122229311
8-[(E)-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-ylidene]methyl]-7H-benzo[7]annulene-6-carbaldehyde (PubChem CID 122229311) has the molecular formula C23H16BrNO3 and a molecular weight of 434.29 g/mol. Its IUPAC name is 8-[(E)-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-ylidene]methyl]-7H-benzo[7]annulene-6-carbaldehyde.
| Compound Name | 8-[(E)-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-ylidene]methyl]-7H-benzo[7]annulene-6-carbaldehyde |
|---|---|
| PubChem CID | 122229311 |
| Molecular Formula | C23H16BrNO3 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 8-[(E)-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-ylidene]methyl]-7H-benzo[7]annulene-6-carbaldehyde |
| SMILES | O=CC1=Cc2ccccc2C=C(/C=C2\CC(=O)N(c3ccc(Br)cc3)C2=O)C1 |
| InChI | InChI=1S/C23H16BrNO3/c24-20-5-7-21(8-6-20)25-22(27)13-19(23(25)28)11-15-9-16(14-26)12-18-4-2-1-3-17(18)10-15/h1-8,10-12,14H,9,13H2/b19-11+ |
| InChIKey | CSSGQDQBLHKTEX-YBFXNURJSA-N |
| XLogP | 4.71 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|