About 1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene
1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene (PubChem CID 154710057) has the molecular formula C7H8
and a molecular weight of 95.16 g/mol. Its IUPAC name is 1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene.
Analyze 1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene?
The IUPAC name of 1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene (CID 154710057) is 1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene.
What is the SMILES notation for 1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene?
The canonical SMILES for 1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene is [2H]C([2H])=C([2H])C1=CC=CC1.
What is the InChIKey of 1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene?
The InChIKey is QCNANSHOVAHMSD-FUDHJZNOSA-N. The full InChI is InChI=1S/C7H8/c1-2-7-5-3-4-6-7/h2-5H,1,6H2/i1D2,2D.
What are the key properties of 1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene?
1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene has a molecular weight of 95.16 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene is sourced from PubChem (CID 154710057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).