C19H17N — CID 101013557
2,6-bis[(Z)-2-cyclopenta-1,3-dien-1-ylethenyl]pyridine (PubChem CID 101013557) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is 2,6-bis[(Z)-2-cyclopenta-1,3-dien-1-ylethenyl]pyridine.
| Compound Name | 2,6-bis[(Z)-2-cyclopenta-1,3-dien-1-ylethenyl]pyridine |
|---|---|
| PubChem CID | 101013557 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2,6-bis[(Z)-2-cyclopenta-1,3-dien-1-ylethenyl]pyridine |
| SMILES | C1=CCC(/C=C\c2cccc(/C=C\C3=CC=CC3)n2)=C1 |
| InChI | InChI=1S/C19H17N/c1-2-7-16(6-1)12-14-18-10-5-11-19(20-18)15-13-17-8-3-4-9-17/h1-6,8,10-15H,7,9H2/b14-12-,15-13- |
| InChIKey | ASWWOYBRMMTROM-DZDAAMPGSA-N |
| XLogP | 4.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |