C11H11+ — CID 177466863
1-[(E)-cyclopent-2-en-1-ylidenemethyl]cyclopenta-1,3-diene (PubChem CID 177466863) has the molecular formula C11H11+ and a molecular weight of 143.21 g/mol. Its IUPAC name is 1-[(E)-cyclopent-2-en-1-ylidenemethyl]cyclopenta-1,3-diene.
| Compound Name | 1-[(E)-cyclopent-2-en-1-ylidenemethyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 177466863 |
| Molecular Formula | C11H11+ |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 1-[(E)-cyclopent-2-en-1-ylidenemethyl]cyclopenta-1,3-diene |
| SMILES | C1=CCC(/C=C2/C=C[CH+]C2)=C1 |
| InChI | InChI=1S/C11H11/c1-2-6-10(5-1)9-11-7-3-4-8-11/h1-5,7,9H,6,8H2/q+1/b10-9- |
| InChIKey | HJVKYXGYRWLDAQ-KTKRTIGZSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|