C13H18Si — CID 18430507
di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane (PubChem CID 18430507) has the molecular formula C13H18Si and a molecular weight of 202.37 g/mol. Its IUPAC name is di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane.
| Compound Name | di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane |
|---|---|
| PubChem CID | 18430507 |
| Molecular Formula | C13H18Si |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane |
| SMILES | CC[Si](C)(C1=CC=CC1)C1=CC=CC1 |
| InChI | InChI=1S/C13H18Si/c1-3-14(2,12-8-4-5-9-12)13-10-6-7-11-13/h4-8,10H,3,9,11H2,1-2H3 |
| InChIKey | HQZADNSUMUYXMA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|