About lithium;di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane;hydride
lithium;di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane;hydride (PubChem CID 173341815) has the molecular formula C13H19LiSi
and a molecular weight of 210.32 g/mol. Its IUPAC name is lithium;di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane;hydride.
Molecular Properties
| Compound Name | lithium;di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane;hydride |
| PubChem CID | 173341815 |
| Molecular Formula | C13H19LiSi |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | lithium;di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane;hydride |
| SMILES | CC[Si](C)(C1=CC=CC1)C1=CC=CC1.[H-].[Li+] |
| InChI | InChI=1S/C13H18Si.Li.H/c1-3-14(2,12-8-4-5-9-12)13-10-6-7-11-13;;/h4-8,10H,3,9,11H2,1-2H3;;/q;+1;-1 |
| InChIKey | FFEIIWIVNKSRPD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze lithium;di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane;hydride?
The IUPAC name of lithium;di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane;hydride (CID 173341815) is lithium;di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane;hydride.
What is the SMILES notation for lithium;di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane;hydride?
The canonical SMILES for lithium;di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane;hydride is CC[Si](C)(C1=CC=CC1)C1=CC=CC1.[H-].[Li+].
What is the InChIKey of lithium;di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane;hydride?
The InChIKey is FFEIIWIVNKSRPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18Si.Li.H/c1-3-14(2,12-8-4-5-9-12)13-10-6-7-11-13;;/h4-8,10H,3,9,11H2,1-2H3;;/q;+1;-1.
What are the key properties of lithium;di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane;hydride?
lithium;di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane;hydride has a molecular weight of 210.32 g/mol, XLogP of 1.05, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;di(cyclopenta-1,3-dien-1-yl)-ethyl-methylsilane;hydride is sourced from PubChem (CID 173341815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).