C26H46OSi2 — CID 90312709
dibutyl-cyclopenta-1,3-dien-1-yl-[dibutyl(cyclopenta-1,3-dien-1-yl)silyl]oxysilane (PubChem CID 90312709) has the molecular formula C26H46OSi2 and a molecular weight of 430.83 g/mol. Its IUPAC name is dibutyl-cyclopenta-1,3-dien-1-yl-[dibutyl(cyclopenta-1,3-dien-1-yl)silyl]oxysilane.
| Compound Name | dibutyl-cyclopenta-1,3-dien-1-yl-[dibutyl(cyclopenta-1,3-dien-1-yl)silyl]oxysilane |
|---|---|
| PubChem CID | 90312709 |
| Molecular Formula | C26H46OSi2 |
| Molecular Weight | 430.83 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | dibutyl-cyclopenta-1,3-dien-1-yl-[dibutyl(cyclopenta-1,3-dien-1-yl)silyl]oxysilane |
| SMILES | CCCC[Si](CCCC)(O[Si](CCCC)(CCCC)C1=CC=CC1)C1=CC=CC1 |
| InChI | InChI=1S/C26H46OSi2/c1-5-9-21-28(22-10-6-2,25-17-13-14-18-25)27-29(23-11-7-3,24-12-8-4)26-19-15-16-20-26/h13-17,19H,5-12,18,20-24H2,1-4H3 |
| InChIKey | YMWFMVPGUHTSPJ-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.83 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|