C13H23P — CID 157457029
dibutyl(cyclopenta-1,3-dien-1-yl)phosphane (PubChem CID 157457029) has the molecular formula C13H23P and a molecular weight of 210.30 g/mol. Its IUPAC name is dibutyl(cyclopenta-1,3-dien-1-yl)phosphane.
| Compound Name | dibutyl(cyclopenta-1,3-dien-1-yl)phosphane |
|---|---|
| PubChem CID | 157457029 |
| Molecular Formula | C13H23P |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | dibutyl(cyclopenta-1,3-dien-1-yl)phosphane |
| SMILES | CCCCP(CCCC)C1=CC=CC1 |
| InChI | InChI=1S/C13H23P/c1-3-5-11-14(12-6-4-2)13-9-7-8-10-13/h7-9H,3-6,10-12H2,1-2H3 |
| InChIKey | KGDAVTSGHZFIBV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|