C13H25N2P — CID 169488035
N-[cyclopenta-1,3-dien-1-yl(diethylamino)phosphanyl]-N-ethylethanamine (PubChem CID 169488035) has the molecular formula C13H25N2P and a molecular weight of 240.33 g/mol. Its IUPAC name is N-[cyclopenta-1,3-dien-1-yl(diethylamino)phosphanyl]-N-ethylethanamine.
| Compound Name | N-[cyclopenta-1,3-dien-1-yl(diethylamino)phosphanyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 169488035 |
| Molecular Formula | C13H25N2P |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | N-[cyclopenta-1,3-dien-1-yl(diethylamino)phosphanyl]-N-ethylethanamine |
| SMILES | CCN(CC)P(C1=CC=CC1)N(CC)CC |
| InChI | InChI=1S/C13H25N2P/c1-5-14(6-2)16(15(7-3)8-4)13-11-9-10-12-13/h9-11H,5-8,12H2,1-4H3 |
| InChIKey | QPFUXZKJLSMYHR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|