C22H46N2P2Si4 — CID 101382524
1-[[bis(trimethylsilyl)amino]-[[bis(trimethylsilyl)amino]-cyclopenta-1,3-dien-1-ylphosphanyl]phosphanyl]cyclopenta-1,3-diene (PubChem CID 101382524) has the molecular formula C22H46N2P2Si4 and a molecular weight of 512.92 g/mol. Its IUPAC name is 1-[[bis(trimethylsilyl)amino]-[[bis(trimethylsilyl)amino]-cyclopenta-1,3-dien-1-ylphosphanyl]phosphanyl]cyclopenta-1,3-diene.
| Compound Name | 1-[[bis(trimethylsilyl)amino]-[[bis(trimethylsilyl)amino]-cyclopenta-1,3-dien-1-ylphosphanyl]phosphanyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 101382524 |
| Molecular Formula | C22H46N2P2Si4 |
| Molecular Weight | 512.92 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 1-[[bis(trimethylsilyl)amino]-[[bis(trimethylsilyl)amino]-cyclopenta-1,3-dien-1-ylphosphanyl]phosphanyl]cyclopenta-1,3-diene |
| SMILES | C[Si](C)(C)N(P(C1=CC=CC1)P(C1=CC=CC1)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C22H46N2P2Si4/c1-27(2,3)23(28(4,5)6)25(21-17-13-14-18-21)26(22-19-15-16-20-22)24(29(7,8)9)30(10,11)12/h13-17,19H,18,20H2,1-12H3 |
| InChIKey | QYRRSOGZNUHVIV-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.92 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|