About 9-oxa-10-azatricyclo[6.1.1.02,7]deca-1(10),2,4,7-tetraene
9-oxa-10-azatricyclo[6.1.1.02,7]deca-1(10),2,4,7-tetraene (PubChem CID 91396425) has the molecular formula C8H5NO
and a molecular weight of 131.13 g/mol. Its IUPAC name is 9-oxa-10-azatricyclo[6.1.1.02,7]deca-1(10),2,4,7-tetraene.
Analyze 9-oxa-10-azatricyclo[6.1.1.02,7]deca-1(10),2,4,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-oxa-10-azatricyclo[6.1.1.02,7]deca-1(10),2,4,7-tetraene?
The IUPAC name of 9-oxa-10-azatricyclo[6.1.1.02,7]deca-1(10),2,4,7-tetraene (CID 91396425) is 9-oxa-10-azatricyclo[6.1.1.02,7]deca-1(10),2,4,7-tetraene.
What is the SMILES notation for 9-oxa-10-azatricyclo[6.1.1.02,7]deca-1(10),2,4,7-tetraene?
The canonical SMILES for 9-oxa-10-azatricyclo[6.1.1.02,7]deca-1(10),2,4,7-tetraene is C1=CCc2c3oc(c2=C1)=N3.
What is the InChIKey of 9-oxa-10-azatricyclo[6.1.1.02,7]deca-1(10),2,4,7-tetraene?
The InChIKey is MRQRNOJFQAWYAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO/c1-2-4-6-5(3-1)7-9-8(6)10-7/h1-3H,4H2.
What are the key properties of 9-oxa-10-azatricyclo[6.1.1.02,7]deca-1(10),2,4,7-tetraene?
9-oxa-10-azatricyclo[6.1.1.02,7]deca-1(10),2,4,7-tetraene has a molecular weight of 131.13 g/mol, XLogP of 0.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxa-10-azatricyclo[6.1.1.02,7]deca-1(10),2,4,7-tetraene is sourced from PubChem (CID 91396425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).