C6H5Br2N — CID 143991393
2,7-dibromo-3H-azepine (PubChem CID 143991393) has the molecular formula C6H5Br2N and a molecular weight of 250.92 g/mol. Its IUPAC name is 2,7-dibromo-3H-azepine.
| Compound Name | 2,7-dibromo-3H-azepine |
|---|---|
| PubChem CID | 143991393 |
| Molecular Formula | C6H5Br2N |
| Molecular Weight | 250.92 g/mol |
| Exact Mass | 248.88 |
| IUPAC Name | 2,7-dibromo-3H-azepine |
| SMILES | BrC1=CC=CCC(Br)=N1 |
| InChI | InChI=1S/C6H5Br2N/c7-5-3-1-2-4-6(8)9-5/h1-3H,4H2 |
| InChIKey | UHWNHCVKPDNJJV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.92 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|