C20H38O3Si — CID 153307547
tributoxy-[(1E,3Z)-cycloocta-1,3-dien-1-yl]silane (PubChem CID 153307547) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is tributoxy-[(1E,3Z)-cycloocta-1,3-dien-1-yl]silane.
| Compound Name | tributoxy-[(1E,3Z)-cycloocta-1,3-dien-1-yl]silane |
|---|---|
| PubChem CID | 153307547 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | tributoxy-[(1E,3Z)-cycloocta-1,3-dien-1-yl]silane |
| SMILES | CCCCO[Si](OCCCC)(OCCCC)/C1=C/C=C\CCCC1 |
| InChI | InChI=1S/C20H38O3Si/c1-4-7-17-21-24(22-18-8-5-2,23-19-9-6-3)20-15-13-11-10-12-14-16-20/h11,13,15H,4-10,12,14,16-19H2,1-3H3/b13-11-,20-15+ |
| InChIKey | PGPPQTIEAJZRKM-KVWUQHRGSA-N |
| XLogP | 5.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|