C18H29I3O3Si — CID 153491475
tributoxy-(2,3,4-triiodophenyl)silane (PubChem CID 153491475) has the molecular formula C18H29I3O3Si and a molecular weight of 702.22 g/mol. Its IUPAC name is tributoxy-(2,3,4-triiodophenyl)silane.
| Compound Name | tributoxy-(2,3,4-triiodophenyl)silane |
|---|---|
| PubChem CID | 153491475 |
| Molecular Formula | C18H29I3O3Si |
| Molecular Weight | 702.22 g/mol |
| Exact Mass | 701.90 |
| IUPAC Name | tributoxy-(2,3,4-triiodophenyl)silane |
| SMILES | CCCCO[Si](OCCCC)(OCCCC)c1ccc(I)c(I)c1I |
| InChI | InChI=1S/C18H29I3O3Si/c1-4-7-12-22-25(23-13-8-5-2,24-14-9-6-3)16-11-10-15(19)17(20)18(16)21/h10-11H,4-9,12-14H2,1-3H3 |
| InChIKey | QMNHNNVLCAEBOQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.22 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|