C11H14I3N — CID 173038518
2,3,4-triiodo-N-pentylaniline (PubChem CID 173038518) has the molecular formula C11H14I3N and a molecular weight of 540.95 g/mol. Its IUPAC name is 2,3,4-triiodo-N-pentylaniline.
| Compound Name | 2,3,4-triiodo-N-pentylaniline |
|---|---|
| PubChem CID | 173038518 |
| Molecular Formula | C11H14I3N |
| Molecular Weight | 540.95 g/mol |
| Exact Mass | 540.83 |
| IUPAC Name | 2,3,4-triiodo-N-pentylaniline |
| SMILES | CCCCCNc1ccc(I)c(I)c1I |
| InChI | InChI=1S/C11H14I3N/c1-2-3-4-7-15-9-6-5-8(12)10(13)11(9)14/h5-6,15H,2-4,7H2,1H3 |
| InChIKey | MGUCUKREOHFJFY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.95 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|