C54H104O12Si4 — CID 87873326
tributoxy-(4-tributoxysilylphenyl)silane;tri(propan-2-yloxy)-[4-tri(propan-2-yloxy)silylphenyl]silane (PubChem CID 87873326) has the molecular formula C54H104O12Si4 and a molecular weight of 1057.76 g/mol. Its IUPAC name is tributoxy-(4-tributoxysilylphenyl)silane;tri(propan-2-yloxy)-[4-tri(propan-2-yloxy)silylphenyl]silane.
| Compound Name | tributoxy-(4-tributoxysilylphenyl)silane;tri(propan-2-yloxy)-[4-tri(propan-2-yloxy)silylphenyl]silane |
|---|---|
| PubChem CID | 87873326 |
| Molecular Formula | C54H104O12Si4 |
| Molecular Weight | 1057.76 g/mol |
| Exact Mass | 1056.66 |
| IUPAC Name | tributoxy-(4-tributoxysilylphenyl)silane;tri(propan-2-yloxy)-[4-tri(propan-2-yloxy)silylphenyl]silane |
| SMILES | CC(C)O[Si](OC(C)C)(OC(C)C)c1ccc([Si](OC(C)C)(OC(C)C)OC(C)C)cc1.CCCCO[Si](OCCCC)(OCCCC)c1ccc([Si](OCCCC)(OCCCC)OCCCC)cc1 |
| InChI | InChI=1S/C30H58O6Si2.C24H46O6Si2/c1-7-13-23-31-37(32-24-14-8-2,33-25-15-9-3)29-19-21-30(22-20-29)38(34-26-16-10-4,35-27-17-11-5)36-28-18-12-6;1-17(2)25-31(26-18(3)4,27-19(5)6)23-13-15-24(16-14-23)32(28-20(7)8,29-21(9)10)30-22(11)12/h19-22H,7-18,23-28H2,1-6H3;13-22H,1-12H3 |
| InChIKey | FUISBLKIROJPOZ-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1057.76 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|