About 4-tripropoxysilylphenol
4-tripropoxysilylphenol (PubChem CID 141199988) has the molecular formula C15H26O4Si
and a molecular weight of 298.45 g/mol. Its IUPAC name is 4-tripropoxysilylphenol.
Molecular Properties
| Compound Name | 4-tripropoxysilylphenol |
| PubChem CID | 141199988 |
| Molecular Formula | C15H26O4Si |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 4-tripropoxysilylphenol |
| SMILES | CCCO[Si](OCCC)(OCCC)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H26O4Si/c1-4-11-17-20(18-12-5-2,19-13-6-3)15-9-7-14(16)8-10-15/h7-10,16H,4-6,11-13H2,1-3H3 |
| InChIKey | SZYJSPKUWPOLLR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-tripropoxysilylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tripropoxysilylphenol?
The IUPAC name of 4-tripropoxysilylphenol (CID 141199988) is 4-tripropoxysilylphenol.
What is the SMILES notation for 4-tripropoxysilylphenol?
The canonical SMILES for 4-tripropoxysilylphenol is CCCO[Si](OCCC)(OCCC)c1ccc(O)cc1.
What is the InChIKey of 4-tripropoxysilylphenol?
The InChIKey is SZYJSPKUWPOLLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O4Si/c1-4-11-17-20(18-12-5-2,19-13-6-3)15-9-7-14(16)8-10-15/h7-10,16H,4-6,11-13H2,1-3H3.
What are the key properties of 4-tripropoxysilylphenol?
4-tripropoxysilylphenol has a molecular weight of 298.45 g/mol, XLogP of 2.82, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tripropoxysilylphenol is sourced from PubChem (CID 141199988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).