C24H28OSi — CID 153277090
4-[4-[4-[butyl(dimethyl)silyl]phenyl]phenyl]phenol (PubChem CID 153277090) has the molecular formula C24H28OSi and a molecular weight of 360.57 g/mol. Its IUPAC name is 4-[4-[4-[butyl(dimethyl)silyl]phenyl]phenyl]phenol.
| Compound Name | 4-[4-[4-[butyl(dimethyl)silyl]phenyl]phenyl]phenol |
|---|---|
| PubChem CID | 153277090 |
| Molecular Formula | C24H28OSi |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 4-[4-[4-[butyl(dimethyl)silyl]phenyl]phenyl]phenol |
| SMILES | CCCC[Si](C)(C)c1ccc(-c2ccc(-c3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H28OSi/c1-4-5-18-26(2,3)24-16-12-22(13-17-24)20-8-6-19(7-9-20)21-10-14-23(25)15-11-21/h6-17,25H,4-5,18H2,1-3H3 |
| InChIKey | BKPXFRWEWXGLCN-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|