C40H46O8Si — CID 153277017
[5-[4-[4-[butyl(dimethyl)silyl]phenyl]phenyl]-2-[(2,6-dioxooxan-4-yl)methoxy]-3-(2-methylprop-2-enoyloxymethyl)phenyl]methyl 2-methylprop-2-enoate (PubChem CID 153277017) has the molecular formula C40H46O8Si and a molecular weight of 682.89 g/mol. Its IUPAC name is [5-[4-[4-[butyl(dimethyl)silyl]phenyl]phenyl]-2-[(2,6-dioxooxan-4-yl)methoxy]-3-(2-methylprop-2-enoyloxymethyl)phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [5-[4-[4-[butyl(dimethyl)silyl]phenyl]phenyl]-2-[(2,6-dioxooxan-4-yl)methoxy]-3-(2-methylprop-2-enoyloxymethyl)phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153277017 |
| Molecular Formula | C40H46O8Si |
| Molecular Weight | 682.89 g/mol |
| Exact Mass | 682.30 |
| IUPAC Name | [5-[4-[4-[butyl(dimethyl)silyl]phenyl]phenyl]-2-[(2,6-dioxooxan-4-yl)methoxy]-3-(2-methylprop-2-enoyloxymethyl)phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(-c2ccc(-c3ccc([Si](C)(C)CCCC)cc3)cc2)cc(COC(=O)C(=C)C)c1OCC1CC(=O)OC(=O)C1 |
| InChI | InChI=1S/C40H46O8Si/c1-8-9-18-49(6,7)35-16-14-30(15-17-35)29-10-12-31(13-11-29)32-21-33(24-46-39(43)26(2)3)38(34(22-32)25-47-40(44)27(4)5)45-23-28-19-36(41)48-37(42)20-28/h10-17,21-22,28H,2,4,8-9,18-20,23-25H2,1,3,5-7H3 |
| InChIKey | SNGUQOOQDBITAN-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.89 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|