C28H42O5Si — CID 153277075
[5-[4-[butyl(dimethyl)silyl]cyclohexyl]-2-hydroxy-3-(2-methylprop-2-enoyloxymethyl)phenyl]methyl 2-methylprop-2-enoate (PubChem CID 153277075) has the molecular formula C28H42O5Si and a molecular weight of 486.73 g/mol. Its IUPAC name is [5-[4-[butyl(dimethyl)silyl]cyclohexyl]-2-hydroxy-3-(2-methylprop-2-enoyloxymethyl)phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [5-[4-[butyl(dimethyl)silyl]cyclohexyl]-2-hydroxy-3-(2-methylprop-2-enoyloxymethyl)phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153277075 |
| Molecular Formula | C28H42O5Si |
| Molecular Weight | 486.73 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | [5-[4-[butyl(dimethyl)silyl]cyclohexyl]-2-hydroxy-3-(2-methylprop-2-enoyloxymethyl)phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(C2CCC([Si](C)(C)CCCC)CC2)cc(COC(=O)C(=C)C)c1O |
| InChI | InChI=1S/C28H42O5Si/c1-8-9-14-34(6,7)25-12-10-21(11-13-25)22-15-23(17-32-27(30)19(2)3)26(29)24(16-22)18-33-28(31)20(4)5/h15-16,21,25,29H,2,4,8-14,17-18H2,1,3,5-7H3 |
| InChIKey | ITUSLQJGFJYLGI-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.73 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|