C34H50O4Si — CID 153277164
[5-[4-[4-[4-[butyl(dimethyl)silyl]cyclohexyl]phenyl]phenoxy]-2-(hydroxymethyl)pentyl] 2-methylprop-2-enoate (PubChem CID 153277164) has the molecular formula C34H50O4Si and a molecular weight of 550.86 g/mol. Its IUPAC name is [5-[4-[4-[4-[butyl(dimethyl)silyl]cyclohexyl]phenyl]phenoxy]-2-(hydroxymethyl)pentyl] 2-methylprop-2-enoate.
| Compound Name | [5-[4-[4-[4-[butyl(dimethyl)silyl]cyclohexyl]phenyl]phenoxy]-2-(hydroxymethyl)pentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153277164 |
| Molecular Formula | C34H50O4Si |
| Molecular Weight | 550.86 g/mol |
| Exact Mass | 550.35 |
| IUPAC Name | [5-[4-[4-[4-[butyl(dimethyl)silyl]cyclohexyl]phenyl]phenoxy]-2-(hydroxymethyl)pentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)CCCOc1ccc(-c2ccc(C3CCC([Si](C)(C)CCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C34H50O4Si/c1-6-7-23-39(4,5)33-20-16-31(17-21-33)29-12-10-28(11-13-29)30-14-18-32(19-15-30)37-22-8-9-27(24-35)25-38-34(36)26(2)3/h10-15,18-19,27,31,33,35H,2,6-9,16-17,20-25H2,1,3-5H3 |
| InChIKey | HHUXBTQDVKEPLA-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.86 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|