C28H38F2O4Si — CID 147692948
[5-[4-[4-[butyl(dimethyl)silyl]-2,3-difluorophenyl]phenoxy]-2-(hydroxymethyl)pentyl] 2-methylprop-2-enoate (PubChem CID 147692948) has the molecular formula C28H38F2O4Si and a molecular weight of 504.69 g/mol. Its IUPAC name is [5-[4-[4-[butyl(dimethyl)silyl]-2,3-difluorophenyl]phenoxy]-2-(hydroxymethyl)pentyl] 2-methylprop-2-enoate.
| Compound Name | [5-[4-[4-[butyl(dimethyl)silyl]-2,3-difluorophenyl]phenoxy]-2-(hydroxymethyl)pentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 147692948 |
| Molecular Formula | C28H38F2O4Si |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | [5-[4-[4-[butyl(dimethyl)silyl]-2,3-difluorophenyl]phenoxy]-2-(hydroxymethyl)pentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)CCCOc1ccc(-c2ccc([Si](C)(C)CCCC)c(F)c2F)cc1 |
| InChI | InChI=1S/C28H38F2O4Si/c1-6-7-17-35(4,5)25-15-14-24(26(29)27(25)30)22-10-12-23(13-11-22)33-16-8-9-21(18-31)19-34-28(32)20(2)3/h10-15,21,31H,2,6-9,16-19H2,1,3-5H3 |
| InChIKey | GRIBAEAQDLTMHQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|