C35H46F2O7 — CID 138529525
[4-[4-[4-(4-butoxyphenyl)-2,3-difluorophenyl]cyclohexyl]-2-[[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]methyl]butyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 138529525) has the molecular formula C35H46F2O7 and a molecular weight of 616.74 g/mol. Its IUPAC name is [4-[4-[4-(4-butoxyphenyl)-2,3-difluorophenyl]cyclohexyl]-2-[[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]methyl]butyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [4-[4-[4-(4-butoxyphenyl)-2,3-difluorophenyl]cyclohexyl]-2-[[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]methyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 138529525 |
| Molecular Formula | C35H46F2O7 |
| Molecular Weight | 616.74 g/mol |
| Exact Mass | 616.32 |
| IUPAC Name | [4-[4-[4-(4-butoxyphenyl)-2,3-difluorophenyl]cyclohexyl]-2-[[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]methyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(CCC1CCC(c2ccc(-c3ccc(OCCCC)cc3)c(F)c2F)CC1)COC(O)C(=C)CO |
| InChI | InChI=1S/C35H46F2O7/c1-4-5-18-42-29-14-12-28(13-15-29)31-17-16-30(32(36)33(31)37)27-10-8-25(9-11-27)6-7-26(21-43-34(40)23(2)19-38)22-44-35(41)24(3)20-39/h12-17,25-27,34,38-40H,2-11,18-22H2,1H3 |
| InChIKey | DPGAIVRHAPYXIQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.74 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|