C35H52O6Si — CID 153277134
[5-[4-[4-[butyl(dimethyl)silyl]phenyl]phenoxy]-2-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxymethyl]pentyl] 2-methylprop-2-enoate (PubChem CID 153277134) has the molecular formula C35H52O6Si and a molecular weight of 596.88 g/mol. Its IUPAC name is [5-[4-[4-[butyl(dimethyl)silyl]phenyl]phenoxy]-2-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxymethyl]pentyl] 2-methylprop-2-enoate.
| Compound Name | [5-[4-[4-[butyl(dimethyl)silyl]phenyl]phenoxy]-2-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxymethyl]pentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153277134 |
| Molecular Formula | C35H52O6Si |
| Molecular Weight | 596.88 g/mol |
| Exact Mass | 596.35 |
| IUPAC Name | [5-[4-[4-[butyl(dimethyl)silyl]phenyl]phenoxy]-2-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxymethyl]pentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCCOc1ccc(-c2ccc([Si](C)(C)CCCC)cc2)cc1)COCC1COC(C)(C)OC1 |
| InChI | InChI=1S/C35H52O6Si/c1-8-9-21-42(6,7)33-18-14-31(15-19-33)30-12-16-32(17-13-30)38-20-10-11-28(24-39-34(36)27(2)3)22-37-23-29-25-40-35(4,5)41-26-29/h12-19,28-29H,2,8-11,20-26H2,1,3-7H3 |
| InChIKey | HLOODFNYXDVWJF-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.88 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|