C37H46N2O8 — CID 130262955
8-[4-[4-[4-(2-methylprop-2-enoyloxy)-3-(2-methylprop-2-enoyloxymethyl)butoxy]phenyl]phenoxy]octyl 1H-imidazole-5-carboxylate (PubChem CID 130262955) has the molecular formula C37H46N2O8 and a molecular weight of 646.78 g/mol. Its IUPAC name is 8-[4-[4-[4-(2-methylprop-2-enoyloxy)-3-(2-methylprop-2-enoyloxymethyl)butoxy]phenyl]phenoxy]octyl 1H-imidazole-5-carboxylate.
| Compound Name | 8-[4-[4-[4-(2-methylprop-2-enoyloxy)-3-(2-methylprop-2-enoyloxymethyl)butoxy]phenyl]phenoxy]octyl 1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 130262955 |
| Molecular Formula | C37H46N2O8 |
| Molecular Weight | 646.78 g/mol |
| Exact Mass | 646.33 |
| IUPAC Name | 8-[4-[4-[4-(2-methylprop-2-enoyloxy)-3-(2-methylprop-2-enoyloxymethyl)butoxy]phenyl]phenoxy]octyl 1H-imidazole-5-carboxylate |
| SMILES | C=C(C)C(=O)OCC(CCOc1ccc(-c2ccc(OCCCCCCCCOC(=O)c3cnc[nH]3)cc2)cc1)COC(=O)C(=C)C |
| InChI | InChI=1S/C37H46N2O8/c1-27(2)35(40)46-24-29(25-47-36(41)28(3)4)19-22-44-33-17-13-31(14-18-33)30-11-15-32(16-12-30)43-20-9-7-5-6-8-10-21-45-37(42)34-23-38-26-39-34/h11-18,23,26,29H,1,3,5-10,19-22,24-25H2,2,4H3,(H,38,39) |
| InChIKey | QZQDCCJJLYZEAU-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.78 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|