C45H65NO8 — CID 163607935
3-[5-(4-hexoxyphenyl)-3-[3-(2-methylprop-2-enoyloxy)propyl]-2-[(8,8,10,10-tetramethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methoxy]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 163607935) has the molecular formula C45H65NO8 and a molecular weight of 748.01 g/mol. Its IUPAC name is 3-[5-(4-hexoxyphenyl)-3-[3-(2-methylprop-2-enoyloxy)propyl]-2-[(8,8,10,10-tetramethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methoxy]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[5-(4-hexoxyphenyl)-3-[3-(2-methylprop-2-enoyloxy)propyl]-2-[(8,8,10,10-tetramethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methoxy]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163607935 |
| Molecular Formula | C45H65NO8 |
| Molecular Weight | 748.01 g/mol |
| Exact Mass | 747.47 |
| IUPAC Name | 3-[5-(4-hexoxyphenyl)-3-[3-(2-methylprop-2-enoyloxy)propyl]-2-[(8,8,10,10-tetramethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methoxy]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(OCCCCCC)cc2)cc(CCCOC(=O)C(=C)C)c1OCC1COC2(CC(C)(C)NC(C)(C)C2)OC1 |
| InChI | InChI=1S/C45H65NO8/c1-10-11-12-13-22-49-39-20-18-35(19-21-39)38-25-36(16-14-23-50-41(47)32(2)3)40(37(26-38)17-15-24-51-42(48)33(4)5)52-27-34-28-53-45(54-29-34)30-43(6,7)46-44(8,9)31-45/h18-21,25-26,34,46H,2,4,10-17,22-24,27-31H2,1,3,5-9H3 |
| InChIKey | HDJZNXOJRQZJOE-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.01 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|