C37H52O7 — CID 139442831
3-[2-decoxy-5-[3,5-dimethyl-4-[(5-methyl-2-oxo-1,3-dioxan-5-yl)methoxy]phenyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 139442831) has the molecular formula C37H52O7 and a molecular weight of 608.82 g/mol. Its IUPAC name is 3-[2-decoxy-5-[3,5-dimethyl-4-[(5-methyl-2-oxo-1,3-dioxan-5-yl)methoxy]phenyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-decoxy-5-[3,5-dimethyl-4-[(5-methyl-2-oxo-1,3-dioxan-5-yl)methoxy]phenyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139442831 |
| Molecular Formula | C37H52O7 |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.37 |
| IUPAC Name | 3-[2-decoxy-5-[3,5-dimethyl-4-[(5-methyl-2-oxo-1,3-dioxan-5-yl)methoxy]phenyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2cc(C)c(OCC3(C)COC(=O)OC3)c(C)c2)ccc1OCCCCCCCCCC |
| InChI | InChI=1S/C37H52O7/c1-7-8-9-10-11-12-13-14-19-40-33-18-17-30(23-31(33)16-15-20-41-35(38)27(2)3)32-21-28(4)34(29(5)22-32)42-24-37(6)25-43-36(39)44-26-37/h17-18,21-23H,2,7-16,19-20,24-26H2,1,3-6H3 |
| InChIKey | ASJQWDVVITXLHU-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|