C34H46O7 — CID 139442755
3-[5-(3,5-dimethyl-4-octoxyphenyl)-2-[(2-oxo-1,3-dioxan-5-yl)methoxy]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 139442755) has the molecular formula C34H46O7 and a molecular weight of 566.74 g/mol. Its IUPAC name is 3-[5-(3,5-dimethyl-4-octoxyphenyl)-2-[(2-oxo-1,3-dioxan-5-yl)methoxy]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[5-(3,5-dimethyl-4-octoxyphenyl)-2-[(2-oxo-1,3-dioxan-5-yl)methoxy]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139442755 |
| Molecular Formula | C34H46O7 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.32 |
| IUPAC Name | 3-[5-(3,5-dimethyl-4-octoxyphenyl)-2-[(2-oxo-1,3-dioxan-5-yl)methoxy]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2cc(C)c(OCCCCCCCC)c(C)c2)ccc1OCC1COC(=O)OC1 |
| InChI | InChI=1S/C34H46O7/c1-6-7-8-9-10-11-16-37-32-25(4)18-30(19-26(32)5)28-14-15-31(39-21-27-22-40-34(36)41-23-27)29(20-28)13-12-17-38-33(35)24(2)3/h14-15,18-20,27H,2,6-13,16-17,21-23H2,1,3-5H3 |
| InChIKey | ZGKDORNXZFXHBR-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|