C31H39FO7 — CID 139442882
2-[2-(3-fluoro-4-octoxyphenyl)-5-[(2-oxo-1,3-dioxan-5-yl)methoxy]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 139442882) has the molecular formula C31H39FO7 and a molecular weight of 542.64 g/mol. Its IUPAC name is 2-[2-(3-fluoro-4-octoxyphenyl)-5-[(2-oxo-1,3-dioxan-5-yl)methoxy]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-(3-fluoro-4-octoxyphenyl)-5-[(2-oxo-1,3-dioxan-5-yl)methoxy]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139442882 |
| Molecular Formula | C31H39FO7 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 2-[2-(3-fluoro-4-octoxyphenyl)-5-[(2-oxo-1,3-dioxan-5-yl)methoxy]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(OCC2COC(=O)OC2)ccc1-c1ccc(OCCCCCCCC)c(F)c1 |
| InChI | InChI=1S/C31H39FO7/c1-4-5-6-7-8-9-15-35-29-13-10-24(18-28(29)32)27-12-11-26(37-19-23-20-38-31(34)39-21-23)17-25(27)14-16-36-30(33)22(2)3/h10-13,17-18,23H,2,4-9,14-16,19-21H2,1,3H3 |
| InChIKey | UNEAGKMMPHBKEB-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|