C40H42F2O5Si — CID 149270419
[5-[4-[4-[4-[butyl(dimethyl)silyl]phenyl]phenyl]-2,3-difluorophenyl]-2-hydroxy-3-(2-methylprop-2-enoyloxymethyl)phenyl]methyl 2-methylprop-2-enoate (PubChem CID 149270419) has the molecular formula C40H42F2O5Si and a molecular weight of 668.85 g/mol. Its IUPAC name is [5-[4-[4-[4-[butyl(dimethyl)silyl]phenyl]phenyl]-2,3-difluorophenyl]-2-hydroxy-3-(2-methylprop-2-enoyloxymethyl)phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [5-[4-[4-[4-[butyl(dimethyl)silyl]phenyl]phenyl]-2,3-difluorophenyl]-2-hydroxy-3-(2-methylprop-2-enoyloxymethyl)phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 149270419 |
| Molecular Formula | C40H42F2O5Si |
| Molecular Weight | 668.85 g/mol |
| Exact Mass | 668.28 |
| IUPAC Name | [5-[4-[4-[4-[butyl(dimethyl)silyl]phenyl]phenyl]-2,3-difluorophenyl]-2-hydroxy-3-(2-methylprop-2-enoyloxymethyl)phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(-c2ccc(-c3ccc(-c4ccc([Si](C)(C)CCCC)cc4)cc3)c(F)c2F)cc(COC(=O)C(=C)C)c1O |
| InChI | InChI=1S/C40H42F2O5Si/c1-8-9-20-48(6,7)33-16-14-28(15-17-33)27-10-12-29(13-11-27)34-18-19-35(37(42)36(34)41)30-21-31(23-46-39(44)25(2)3)38(43)32(22-30)24-47-40(45)26(4)5/h10-19,21-22,43H,2,4,8-9,20,23-24H2,1,3,5-7H3 |
| InChIKey | XQYSOFCXDBEKKI-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.85 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|