C35H42F2O3Si — CID 153277144
[5-[4-[4-[4-[butyl(dimethyl)silyl]cyclohexyl]phenyl]-2,3-difluorophenyl]-2-hydroxyphenyl]methyl 2-methylprop-2-enoate (PubChem CID 153277144) has the molecular formula C35H42F2O3Si and a molecular weight of 576.80 g/mol. Its IUPAC name is [5-[4-[4-[4-[butyl(dimethyl)silyl]cyclohexyl]phenyl]-2,3-difluorophenyl]-2-hydroxyphenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [5-[4-[4-[4-[butyl(dimethyl)silyl]cyclohexyl]phenyl]-2,3-difluorophenyl]-2-hydroxyphenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153277144 |
| Molecular Formula | C35H42F2O3Si |
| Molecular Weight | 576.80 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | [5-[4-[4-[4-[butyl(dimethyl)silyl]cyclohexyl]phenyl]-2,3-difluorophenyl]-2-hydroxyphenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(-c2ccc(-c3ccc(C4CCC([Si](C)(C)CCCC)CC4)cc3)c(F)c2F)ccc1O |
| InChI | InChI=1S/C35H42F2O3Si/c1-6-7-20-41(4,5)29-15-12-25(13-16-29)24-8-10-26(11-9-24)30-17-18-31(34(37)33(30)36)27-14-19-32(38)28(21-27)22-40-35(39)23(2)3/h8-11,14,17-19,21,25,29,38H,2,6-7,12-13,15-16,20,22H2,1,3-5H3 |
| InChIKey | WPYWGQQJEPNNEF-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.80 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|