C36H49FO8 — CID 154968328
[5-(3-fluoro-4-octoxyphenyl)-2-[3-methoxy-2-(methoxymethyl)propoxy]-3-(2-methylprop-2-enoyloxymethyl)phenyl]methyl 2-methylprop-2-enoate (PubChem CID 154968328) has the molecular formula C36H49FO8 and a molecular weight of 628.78 g/mol. Its IUPAC name is [5-(3-fluoro-4-octoxyphenyl)-2-[3-methoxy-2-(methoxymethyl)propoxy]-3-(2-methylprop-2-enoyloxymethyl)phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [5-(3-fluoro-4-octoxyphenyl)-2-[3-methoxy-2-(methoxymethyl)propoxy]-3-(2-methylprop-2-enoyloxymethyl)phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154968328 |
| Molecular Formula | C36H49FO8 |
| Molecular Weight | 628.78 g/mol |
| Exact Mass | 628.34 |
| IUPAC Name | [5-(3-fluoro-4-octoxyphenyl)-2-[3-methoxy-2-(methoxymethyl)propoxy]-3-(2-methylprop-2-enoyloxymethyl)phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(-c2ccc(OCCCCCCCC)c(F)c2)cc(COC(=O)C(=C)C)c1OCC(COC)COC |
| InChI | InChI=1S/C36H49FO8/c1-8-9-10-11-12-13-16-42-33-15-14-28(19-32(33)37)29-17-30(23-44-35(38)25(2)3)34(43-22-27(20-40-6)21-41-7)31(18-29)24-45-36(39)26(4)5/h14-15,17-19,27H,2,4,8-13,16,20-24H2,1,3,5-7H3 |
| InChIKey | RYNPJIRIFCNAFP-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.78 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|