C31H26F2O4 — CID 134201012
[5-[2-fluoro-4-(2-fluoro-4-phenylphenyl)phenyl]-2-(2-hydroxyethoxy)phenyl]methyl 2-methylprop-2-enoate (PubChem CID 134201012) has the molecular formula C31H26F2O4 and a molecular weight of 500.54 g/mol. Its IUPAC name is [5-[2-fluoro-4-(2-fluoro-4-phenylphenyl)phenyl]-2-(2-hydroxyethoxy)phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [5-[2-fluoro-4-(2-fluoro-4-phenylphenyl)phenyl]-2-(2-hydroxyethoxy)phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134201012 |
| Molecular Formula | C31H26F2O4 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | [5-[2-fluoro-4-(2-fluoro-4-phenylphenyl)phenyl]-2-(2-hydroxyethoxy)phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(-c2ccc(-c3ccc(-c4ccccc4)cc3F)cc2F)ccc1OCCO |
| InChI | InChI=1S/C31H26F2O4/c1-20(2)31(35)37-19-25-16-23(10-13-30(25)36-15-14-34)26-12-9-24(18-29(26)33)27-11-8-22(17-28(27)32)21-6-4-3-5-7-21/h3-13,16-18,34H,1,14-15,19H2,2H3 |
| InChIKey | DDAFGHBMEQHMAX-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|