C30H58O2Si2 — CID 66774397
butoxy-[4-[butoxy(ditert-butyl)silyl]phenyl]-ditert-butylsilane (PubChem CID 66774397) has the molecular formula C30H58O2Si2 and a molecular weight of 506.96 g/mol. Its IUPAC name is butoxy-[4-[butoxy(ditert-butyl)silyl]phenyl]-ditert-butylsilane.
| Compound Name | butoxy-[4-[butoxy(ditert-butyl)silyl]phenyl]-ditert-butylsilane |
|---|---|
| PubChem CID | 66774397 |
| Molecular Formula | C30H58O2Si2 |
| Molecular Weight | 506.96 g/mol |
| Exact Mass | 506.40 |
| IUPAC Name | butoxy-[4-[butoxy(ditert-butyl)silyl]phenyl]-ditert-butylsilane |
| SMILES | CCCCO[Si](c1ccc([Si](OCCCC)(C(C)(C)C)C(C)(C)C)cc1)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C30H58O2Si2/c1-15-17-23-31-33(27(3,4)5,28(6,7)8)25-19-21-26(22-20-25)34(29(9,10)11,30(12,13)14)32-24-18-16-2/h19-22H,15-18,23-24H2,1-14H3 |
| InChIKey | DANBPPKEFVBTDQ-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.96 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|