C18H18O — CID 177495659
(2E,6Z)-2,6-bis(cyclopenta-1,3-dien-1-ylmethylidene)cyclohexan-1-one (PubChem CID 177495659) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is (2E,6Z)-2,6-bis(cyclopenta-1,3-dien-1-ylmethylidene)cyclohexan-1-one.
| Compound Name | (2E,6Z)-2,6-bis(cyclopenta-1,3-dien-1-ylmethylidene)cyclohexan-1-one |
|---|---|
| PubChem CID | 177495659 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (2E,6Z)-2,6-bis(cyclopenta-1,3-dien-1-ylmethylidene)cyclohexan-1-one |
| SMILES | O=C1/C(=C\C2=CC=CC2)CCC/C1=C\C1=CC=CC1 |
| InChI | InChI=1S/C18H18O/c19-18-16(12-14-6-1-2-7-14)10-5-11-17(18)13-15-8-3-4-9-15/h1-4,6,8,12-13H,5,7,9-11H2/b16-12-,17-13+ |
| InChIKey | BPPBIXDAVUBJBJ-RFTYBOQRSA-N |
| XLogP | 4.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|