C9H8O4 — CID 175513369
5-hydroxycyclohexa-1,3-diene-1,3,5-tricarbaldehyde (PubChem CID 175513369) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is 5-hydroxycyclohexa-1,3-diene-1,3,5-tricarbaldehyde.
| Compound Name | 5-hydroxycyclohexa-1,3-diene-1,3,5-tricarbaldehyde |
|---|---|
| PubChem CID | 175513369 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 5-hydroxycyclohexa-1,3-diene-1,3,5-tricarbaldehyde |
| SMILES | O=CC1=CC(O)(C=O)CC(C=O)=C1 |
| InChI | InChI=1S/C9H8O4/c10-4-7-1-8(5-11)3-9(13,2-7)6-12/h1-2,4-6,13H,3H2 |
| InChIKey | SCMMSTMSYATXLN-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|