C9H10O6 — CID 175477433
1,3,5-trihydroxycyclohex-4-ene-1,2,3-tricarbaldehyde (PubChem CID 175477433) has the molecular formula C9H10O6 and a molecular weight of 214.17 g/mol. Its IUPAC name is 1,3,5-trihydroxycyclohex-4-ene-1,2,3-tricarbaldehyde.
| Compound Name | 1,3,5-trihydroxycyclohex-4-ene-1,2,3-tricarbaldehyde |
|---|---|
| PubChem CID | 175477433 |
| Molecular Formula | C9H10O6 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 1,3,5-trihydroxycyclohex-4-ene-1,2,3-tricarbaldehyde |
| SMILES | O=CC1C(O)(C=O)C=C(O)CC1(O)C=O |
| InChI | InChI=1S/C9H10O6/c10-3-7-8(14,4-11)1-6(13)2-9(7,15)5-12/h1,3-5,7,13-15H,2H2 |
| InChIKey | XQXZIQZTZYJCID-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|