C6H11NO4 — CID 174706706
2,3,4-trihydroxypiperidine-2-carbaldehyde (PubChem CID 174706706) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is 2,3,4-trihydroxypiperidine-2-carbaldehyde.
| Compound Name | 2,3,4-trihydroxypiperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174706706 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 2,3,4-trihydroxypiperidine-2-carbaldehyde |
| SMILES | O=CC1(O)NCCC(O)C1O |
| InChI | InChI=1S/C6H11NO4/c8-3-6(11)5(10)4(9)1-2-7-6/h3-5,7,9-11H,1-2H2 |
| InChIKey | ZRHAATVOHJRFDI-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|