C12H12ClNO3 — CID 174679276
2-[2-(4-chlorophenyl)acetyl]-1,3-oxazolidine-2-carbaldehyde (PubChem CID 174679276) has the molecular formula C12H12ClNO3 and a molecular weight of 253.69 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)acetyl]-1,3-oxazolidine-2-carbaldehyde.
| Compound Name | 2-[2-(4-chlorophenyl)acetyl]-1,3-oxazolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174679276 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 2-[2-(4-chlorophenyl)acetyl]-1,3-oxazolidine-2-carbaldehyde |
| SMILES | O=CC1(C(=O)Cc2ccc(Cl)cc2)NCCO1 |
| InChI | InChI=1S/C12H12ClNO3/c13-10-3-1-9(2-4-10)7-11(16)12(8-15)14-5-6-17-12/h1-4,8,14H,5-7H2 |
| InChIKey | ILVYSNNLPXEECF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|