C8H8O4 — CID 140662479
7a-hydroxy-3aH-1,3-benzodioxole-5-carbaldehyde (PubChem CID 140662479) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is 7a-hydroxy-3aH-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 7a-hydroxy-3aH-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 140662479 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 7a-hydroxy-3aH-1,3-benzodioxole-5-carbaldehyde |
| SMILES | O=CC1=CC2OCOC2(O)C=C1 |
| InChI | InChI=1S/C8H8O4/c9-4-6-1-2-8(10)7(3-6)11-5-12-8/h1-4,7,10H,5H2 |
| InChIKey | SFCQRILJIMRQED-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|