C12H18O — CID 163363398
4-tert-butyl-4-methylcyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 163363398) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is 4-tert-butyl-4-methylcyclohexa-1,5-diene-1-carbaldehyde.
| Compound Name | 4-tert-butyl-4-methylcyclohexa-1,5-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 163363398 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 4-tert-butyl-4-methylcyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | CC(C)(C)C1(C)C=CC(C=O)=CC1 |
| InChI | InChI=1S/C12H18O/c1-11(2,3)12(4)7-5-10(9-13)6-8-12/h5-7,9H,8H2,1-4H3 |
| InChIKey | LLUQWBVLUDXBJG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|