C7H7BrO2 — CID 68820295
7a-bromo-3aH-1,3-benzodioxole (PubChem CID 68820295) has the molecular formula C7H7BrO2 and a molecular weight of 203.03 g/mol. Its IUPAC name is 7a-bromo-3aH-1,3-benzodioxole.
| Compound Name | 7a-bromo-3aH-1,3-benzodioxole |
|---|---|
| PubChem CID | 68820295 |
| Molecular Formula | C7H7BrO2 |
| Molecular Weight | 203.03 g/mol |
| Exact Mass | 201.96 |
| IUPAC Name | 7a-bromo-3aH-1,3-benzodioxole |
| SMILES | BrC12C=CC=CC1OCO2 |
| InChI | InChI=1S/C7H7BrO2/c8-7-4-2-1-3-6(7)9-5-10-7/h1-4,6H,5H2 |
| InChIKey | XKZDCOFNLDBYPQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.03 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|