C6H7OP — CID 141189920
7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ylphosphane (PubChem CID 141189920) has the molecular formula C6H7OP and a molecular weight of 126.09 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ylphosphane.
| Compound Name | 7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ylphosphane |
|---|---|
| PubChem CID | 141189920 |
| Molecular Formula | C6H7OP |
| Molecular Weight | 126.09 g/mol |
| Exact Mass | 126.02 |
| IUPAC Name | 7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ylphosphane |
| SMILES | PC12C=CC=CC1O2 |
| InChI | InChI=1S/C6H7OP/c8-6-4-2-1-3-5(6)7-6/h1-5H,8H2 |
| InChIKey | DAVBPUDGLCBFIZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.09 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|